* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | G-7453 |
| CAS: | 167854-60-6 |
| English Synonyms: | G-7453 |
| MDL Number.: | MFCD00937756 |
| H bond acceptor: | 12 |
| H bond donor: | 4 |
| Smile: | c1cc(ccc1C(=N)N)C(=O)Nc2ccc-3c(c2)C(=O)N(Cc4n3nnn4)CCC(=O)O |
| InChi: | InChI=1S/C20H18N8O4/c21-18(22)11-1-3-12(4-2-11)19(31)23-13-5-6-15-14(9-13)20(32)27(8-7-17(29)30)10-16-24-25-26-28(15)16/h1-6,9H,7-8,10H2,(H3,21,22)(H,23,31)(H,29,30) |
| InChiKey: | InChIKey=SXAVWARGHMNBCH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.