* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ZD-8321 |
| CAS: | 182073-77-4 |
| English Synonyms: | ZD-8321 |
| MDL Number.: | MFCD00949903 |
| H bond acceptor: | 8 |
| H bond donor: | 2 |
| Smile: | CC(C)[C@@H](C(=O)C(F)(F)F)NC(=O)[C@@H]1CCCN1C(=O)[C@H](C(C)C)NC(=O)OC |
| InChi: | InChI=1S/C18H28F3N3O5/c1-9(2)12(14(25)18(19,20)21)22-15(26)11-7-6-8-24(11)16(27)13(10(3)4)23-17(28)29-5/h9-13H,6-8H2,1-5H3,(H,22,26)(H,23,28)/t11-,12-,13-/m0/s1 |
| InChiKey: | InChIKey=ZYLBZJKJNAYAFU-AVGNSLFASA-N |
* If the product has intellectual property rights, a license granted is must or contact us.