* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 2-METHYL-4-PHENYLBUTANAL |
| CAS: | 40654-82-8 |
| English Synonyms: | 2-METHYL-4-PHENYLBUTANAL |
| MDL Number.: | MFCD01024502 |
| H bond acceptor: | 1 |
| H bond donor: | 0 |
| Smile: | CC(CCc1ccccc1)C=O |
| InChi: | InChI=1S/C11H14O/c1-10(9-12)7-8-11-5-3-2-4-6-11/h2-6,9-10H,7-8H2,1H3 |
| InChiKey: | InChIKey=RLFLIPVJQTWXKR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.