Molecular Structure:
CCD No.:CCD08062920
VALYL-TYROSINE[TYROSINE-35-3H]
Formula:C14 H18 N2 O4 T2
MolWeight:284.338
![VALYL-TYROSINE[TYROSINE-35-3H] Detailed](../images/deli.png)
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(1)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(1)
|
|
| Product Name： | VALYL-TYROSINE[TYROSINE-35-3H] |
| English Synonyms： | VALYL-TYROSINE[TYROSINE-35-3H] |
| MDL Number.： | MFCD01076112 |
| H bond acceptor： | 6 |
| H bond donor： | 4 |
| Smile： | [3H]c1cc(cc(c1O)[3H])C[C@@H](C(=O)O)NC(=O)[C@H](C(C)C)N |
| InChiKey： | InChIKey=null |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
