* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | GR-55562 HYDROCHLORIDE |
| English Synonyms: | GR-55562 HYDROCHLORIDE |
| MDL Number.: | MFCD01321062 |
| H bond acceptor: | 5 |
| H bond donor: | 2 |
| Smile: | CN(C)CCCc1cc(ccc1O)C(=O)Nc2ccc(cc2)c3ccncc3.Cl |
| InChi: | InChI=1S/C23H25N3O2.ClH/c1-26(2)15-3-4-19-16-20(7-10-22(19)27)23(28)25-21-8-5-17(6-9-21)18-11-13-24-14-12-18;/h5-14,16,27H,3-4,15H2,1-2H3,(H,25,28);1H |
| InChiKey: | InChIKey=NUDSRNNZTVHCKY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.