* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-METHYL-8-PROPAN-2-YL-5,6,7,8A-TETRAHYDRO-[1,3]THIAZOLO[3,2-A]PYRAZIN-3-ONE |
| English Synonyms: | 8-METHYL-8-PROPAN-2-YL-5,6,7,8A-TETRAHYDRO-[1,3]THIAZOLO[3,2-A]PYRAZIN-3-ONE |
| MDL Number.: | MFCD01465759 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | CC(C)C1(C2N(CCN1)C(=O)CS2)C |
| InChi: | InChI=1S/C10H18N2OS/c1-7(2)10(3)9-12(5-4-11-10)8(13)6-14-9/h7,9,11H,4-6H2,1-3H3 |
| InChiKey: | InChIKey=CZSMWQDPULTUSB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.