* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-CHLORO-9H-PYRIDO[2,3-B]INDOLE |
| CAS: | 74896-09-6 |
| English Synonyms: | 8-CHLORO-9H-PYRIDO[2,3-B]INDOLE |
| MDL Number.: | MFCD01546960 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | c1cc2c3cccnc3[nH]c2c(c1)Cl |
| InChi: | InChI=1S/C11H7ClN2/c12-9-5-1-3-7-8-4-2-6-13-11(8)14-10(7)9/h1-6H,(H,13,14) |
| InChiKey: | InChIKey=UZSSXTAROUXYRN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.