* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-BROMO-7-BUT-2-ENYL-3-METHYL-3,7-DIHYDRO-PURINE-2,6-DIONE |
| English Synonyms: | 8-BROMO-7-BUT-2-ENYL-3-METHYL-3,7-DIHYDRO-PURINE-2,6-DIONE |
| MDL Number.: | MFCD01556307 |
| H bond acceptor: | 6 |
| H bond donor: | 1 |
| Smile: | C/C=C/Cn1c2c(=O)[nH]c(=O)n(c2nc1Br)C |
| InChi: | InChI=1S/C10H11BrN4O2/c1-3-4-5-15-6-7(12-9(15)11)14(2)10(17)13-8(6)16/h3-4H,5H2,1-2H3,(H,13,16,17)/b4-3+ |
| InChiKey: | InChIKey=NKGZSVBQVPISAT-ONEGZZNKSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.