* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-[(E)-BUT-2-ENOXY]-1,3,7-TRIMETHYLPURINE-2,6-DIONE |
| English Synonyms: | 8-[(E)-BUT-2-ENOXY]-1,3,7-TRIMETHYLPURINE-2,6-DIONE |
| MDL Number.: | MFCD01612649 |
| H bond acceptor: | 7 |
| H bond donor: | 0 |
| Smile: | C/C=C/COc1nc2c(n1C)c(=O)n(c(=O)n2C)C |
| InChi: | InChI=1S/C12H16N4O3/c1-5-6-7-19-11-13-9-8(14(11)2)10(17)16(4)12(18)15(9)3/h5-6H,7H2,1-4H3/b6-5+ |
| InChiKey: | InChIKey=CBUYXMBEXLBLQJ-AATRIKPKSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.