* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXIAPPTEC WX690188 |
English Synonyms: | WUXIAPPTEC WX690188 |
MDL Number.: | MFCD01631242 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | c1cscc1/C(=N\O)/N |
InChi: | InChI=1S/C5H6N2OS/c6-5(7-8)4-1-2-9-3-4/h1-3,8H,(H2,6,7) |
InChiKey: | InChIKey=KLQUDAATMCQZEF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.