* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | QUINOVIC ACID |
| CAS: | 465-74-7 |
| English Synonyms: | QUINOVIC ACID |
| MDL Number.: | MFCD01675697 |
| H bond acceptor: | 5 |
| H bond donor: | 3 |
| Smile: | C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)O)C)C)[C@@H]2[C@H]1C)C(=O)O)C(=O)O |
| InChi: | InChI=1S/C30H46O5/c1-17-9-14-29(24(32)33)15-16-30(25(34)35)19(23(29)18(17)2)7-8-21-27(5)12-11-22(31)26(3,4)20(27)10-13-28(21,30)6/h7,17-18,20-23,31H,8-16H2,1-6H3,(H,32,33)(H,34,35)/t17-,18+,20+,21-,22+,23+,27+,28-,29+,30-/m1/s1 |
| InChiKey: | InChIKey=OJUYFGQEMPENCE-DPKHZRJYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.