* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | JAVANICIN |
| CAS: | 476-45-9 |
| English Synonyms: | JAVANICIN |
| MDL Number.: | MFCD01712166 |
| H bond acceptor: | 6 |
| H bond donor: | 2 |
| Smile: | CC1=C(C(=O)c2c(c(cc(c2O)OC)O)C1=O)CC(=O)C |
| InChi: | InChI=1S/C15H14O6/c1-6(16)4-8-7(2)13(18)11-9(17)5-10(21-3)15(20)12(11)14(8)19/h5,17,20H,4H2,1-3H3 |
| InChiKey: | InChIKey=UWONIGLSEZRPGH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.