* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | KANAMYCIN C |
| English Synonyms: | KANAMYCIN C |
| MDL Number.: | MFCD01716628 |
| H bond acceptor: | 15 |
| H bond donor: | 11 |
| Smile: | C1[C@@H]([C@H]([C@@H]([C@H]([C@@H]1N)O[C@@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)N)O)O)O[C@@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)N)N |
| InChi: | InChI=1S/C18H36N4O11/c19-4-1-5(20)16(33-18-13(28)8(21)10(25)6(2-23)31-18)14(29)15(4)32-17-9(22)12(27)11(26)7(3-24)30-17/h4-18,23-29H,1-3,19-22H2/t4-,5+,6+,7+,8-,9+,10+,11+,12+,13+,14-,15+,16-,17+,18+/m0/s1 |
| InChiKey: | InChIKey=WZDRWYJKESFZMB-FQSMHNGLSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.