* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VINERIDINE |
| CAS: | 3489-06-3 |
| English Synonyms: | VINERIDINE |
| MDL Number.: | MFCD01726271 |
| H bond acceptor: | 7 |
| H bond donor: | 1 |
| Smile: | C[C@H]1[C@@H]2CN3CC[C@@]4([C@H]3C[C@@H]2C(=CO1)C(=O)OC)c5ccc(cc5NC4=O)OC |
| InChi: | InChI=1S/C22H26N2O5/c1-12-15-10-24-7-6-22(17-5-4-13(27-2)8-18(17)23-21(22)26)19(24)9-14(15)16(11-29-12)20(25)28-3/h4-5,8,11-12,14-15,19H,6-7,9-10H2,1-3H3,(H,23,26)/t12-,14-,15-,19+,22-/m0/s1 |
| InChiKey: | InChIKey=SRKHGHLMEDVZRX-PNGOUSOWSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.