* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 4-PHENYLCYCLOHEX-3-EN-1-AMINE |
| CAS: | 51171-82-5 |
| English Synonyms: | 4-PHENYLCYCLOHEX-3-EN-1-AMINE |
| MDL Number.: | MFCD01735224 |
| H bond acceptor: | 1 |
| H bond donor: | 1 |
| Smile: | c1ccc(cc1)C2=CCC(CC2)N |
| InChi: | InChI=1S/C12H15N/c13-12-8-6-11(7-9-12)10-4-2-1-3-5-10/h1-6,12H,7-9,13H2 |
| InChiKey: | InChIKey=FNYUULMCDRLBIY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.