* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-ACETYL-3-METHYL-3,8-DIAZABICYCLO-[3,2,1]-OCTANE |
| CAS: | 63978-07-4 |
| English Synonyms: | 8-ACETYL-3-METHYL-3,8-DIAZABICYCLO-[3,2,1]-OCTANE |
| MDL Number.: | MFCD01736226 |
| H bond acceptor: | 3 |
| H bond donor: | 0 |
| Smile: | CC(=O)N1[C@H]2CC[C@@H]1CN(C2)C |
| InChi: | InChI=1S/C9H16N2O/c1-7(12)11-8-3-4-9(11)6-10(2)5-8/h8-9H,3-6H2,1-2H3/t8-,9+ |
| InChiKey: | InChIKey=SWUJAINMZHBCAY-DTORHVGOSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.