* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VINDOROSINE |
| CAS: | 5231-60-7 |
| English Synonyms: | VINDOROSINE |
| MDL Number.: | MFCD01747117 |
| H bond acceptor: | 7 |
| H bond donor: | 1 |
| Smile: | CCC12C=CCN3C1C4(CC3)c5ccccc5N(C4C(C2OC(=O)C)(C(=O)OC)O)C |
| InChi: | InChI=1S/C24H30N2O5/c1-5-22-11-8-13-26-14-12-23(18(22)26)16-9-6-7-10-17(16)25(3)19(23)24(29,21(28)30-4)20(22)31-15(2)27/h6-11,18-20,29H,5,12-14H2,1-4H3 |
| InChiKey: | InChIKey=SASWULSUPROHRT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.