* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-(1-METHYLPYRROLIDIN-2-YL)-1-AZABICYCLO[2.2.2]OCTANE |
| CAS: | 31785-74-7 |
| English Synonyms: | 8-(1-METHYLPYRROLIDIN-2-YL)-1-AZABICYCLO[2.2.2]OCTANE |
| MDL Number.: | MFCD01750029 |
| H bond acceptor: | 2 |
| H bond donor: | 0 |
| Smile: | CN1CCCC1C2CN3CC[C@H]2CC3 |
| InChi: | InChI=1S/C12H22N2/c1-13-6-2-3-12(13)11-9-14-7-4-10(11)5-8-14/h10-12H,2-9H2,1H3 |
| InChiKey: | InChIKey=XHBGHNMVPQNIHV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.