* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-METHOXY-1,3,7-TRIMETHYL-3,7-DIHYDRO-1H-PURINE-2,6-DIONE |
| CAS: | 569-34-6 |
| English Synonyms: | 8-METHOXY-1,3,7-TRIMETHYL-3,7-DIHYDRO-1H-PURINE-2,6-DIONE |
| MDL Number.: | MFCD01810054 |
| H bond acceptor: | 7 |
| H bond donor: | 0 |
| Smile: | Cn1c2c(nc1OC)n(c(=O)n(c2=O)C)C |
| InChi: | InChI=1S/C9H12N4O3/c1-11-5-6(10-8(11)16-4)12(2)9(15)13(3)7(5)14/h1-4H3 |
| InChiKey: | InChIKey=ATPSJRIIRXKPER-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.