* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | QUINAZOLINE-4,7-DIOL |
| English Synonyms: | QUINAZOLINE-4,7-DIOL |
| MDL Number.: | MFCD01823180 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | c1cc2c(cc1O)ncnc2O |
| InChi: | InChI=1S/C8H6N2O2/c11-5-1-2-6-7(3-5)9-4-10-8(6)12/h1-4,11H,(H,9,10,12) |
| InChiKey: | InChIKey=JKXOACZDUZRDQF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.