* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-(ISOPENTYLTHIO)-1,3-DI-ME-7-(2-ME-2-PROPENYL)-3,7-DIHYDRO-1H-PURINE-2,6-DIONE |
| English Synonyms: | 8-(ISOPENTYLTHIO)-1,3-DI-ME-7-(2-ME-2-PROPENYL)-3,7-DIHYDRO-1H-PURINE-2,6-DIONE |
| MDL Number.: | MFCD01942625 |
| H bond acceptor: | 6 |
| H bond donor: | 0 |
| Smile: | CC(C)CCSc1nc2c(n1CC(=C)C)c(=O)n(c(=O)n2C)C |
| InChi: | InChI=1S/C16H24N4O2S/c1-10(2)7-8-23-15-17-13-12(20(15)9-11(3)4)14(21)19(6)16(22)18(13)5/h10H,3,7-9H2,1-2,4-6H3 |
| InChiKey: | InChIKey=QONNSARBPVWWTR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.