Molecular Structure:
CCD No.:CCD08158024
RCL S18725
Formula:C12 H14 Br N3 S
MolWeight:312.234
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(1)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(1)
|
|
| Product Name： | RCL S18725 |
| English Synonyms： | RCL S18725 |
| MDL Number.： | MFCD02697601 |
| H bond acceptor： | 3 |
| H bond donor： | 2 |
| Smile： | C1C2C3C4C\5C(C1C3/C5=N\NC(=S)N)C2C4Br |
| InChi： | InChI=1S/C12H14BrN3S/c13-10-6-2-1-3-4(6)9-8(10)5(2)7(3)11(9)15-16-12(14)17/h2-10H,1H2,(H3,14,16,17)/b15-11+ |
| InChiKey： | InChIKey=WDKGDSOBYBOGRK-RVDMUPIBSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
