* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-(BENZYL(ME)AMINO)-7-(2-MEO-ETHYL)-1,3-DIMETHYL-3,7-DIHYDRO-1H-PURINE-2,6-DIONE |
| English Synonyms: | 8-(BENZYL(ME)AMINO)-7-(2-MEO-ETHYL)-1,3-DIMETHYL-3,7-DIHYDRO-1H-PURINE-2,6-DIONE |
| MDL Number.: | MFCD02925456 |
| H bond acceptor: | 8 |
| H bond donor: | 0 |
| Smile: | Cn1c2c(c(=O)n(c1=O)C)n(c(n2)N(C)Cc3ccccc3)CCOC |
| InChi: | InChI=1S/C18H23N5O3/c1-20(12-13-8-6-5-7-9-13)17-19-15-14(23(17)10-11-26-4)16(24)22(3)18(25)21(15)2/h5-9H,10-12H2,1-4H3 |
| InChiKey: | InChIKey=BTGZPAMZEQPZDY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.