* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-(1-AZEPANYL)-3-METHYL-7-OCTYL-3,7-DIHYDRO-1H-PURINE-2,6-DIONE |
| English Synonyms: | 8-(1-AZEPANYL)-3-METHYL-7-OCTYL-3,7-DIHYDRO-1H-PURINE-2,6-DIONE |
| MDL Number.: | MFCD02983379 |
| H bond acceptor: | 7 |
| H bond donor: | 1 |
| Smile: | CCCCCCCCn1c2c(=O)[nH]c(=O)n(c2nc1N3CCCCCC3)C |
| InChi: | InChI=1S/C20H33N5O2/c1-3-4-5-6-7-12-15-25-16-17(23(2)20(27)22-18(16)26)21-19(25)24-13-10-8-9-11-14-24/h3-15H2,1-2H3,(H,22,26,27) |
| InChiKey: | InChIKey=ZTNWYHRQBRWLIC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.