* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WAY 100135 |
CAS: | 133025-23-7 |
English Synonyms: | WAY 100135 |
MDL Number.: | MFCD03700576 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | CC(C)(C)NC(=O)C(CN1CCN(CC1)c2ccccc2OC)c3ccccc3 |
InChi: | InChI=1S/C24H33N3O2/c1-24(2,3)25-23(28)20(19-10-6-5-7-11-19)18-26-14-16-27(17-15-26)21-12-8-9-13-22(21)29-4/h5-13,20H,14-18H2,1-4H3,(H,25,28) |
InChiKey: | InChIKey=UMTDAKAAYOXIKU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.