* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | XYSMALOBIN |
| English Synonyms: | XYSMALOBIN |
| MDL Number.: | MFCD03940765 |
| H bond acceptor: | 14 |
| H bond donor: | 8 |
| Smile: | CC12CCC(C[C@@H]1CCC3C2CCC4(C3(CCC4C5=CC(=O)OC5)O)C)OC6C(C(C(C(O6)COC7C(C(C(C(O7)CO)O)O)O)O)O)O |
| InChi: | InChI=1S/C35H54O14/c1-33-8-5-18(47-32-30(43)28(41)26(39)23(49-32)15-46-31-29(42)27(40)25(38)22(13-36)48-31)12-17(33)3-4-21-20(33)6-9-34(2)19(7-10-35(21,34)44)16-11-24(37)45-14-16/h11,17-23,25-32,36,38-44H,3-10,12-15H2,1-2H3/t17-,18?,19?,20?,21?,22?,23?,25?,26?,27?,28?,29?,30?,31?,32?,33?,34?,35?/m0/s1 |
| InChiKey: | InChIKey=COIUWGNHAYDCDZ-ATLJBRTFSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.