* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WAY-132983 |
CAS: | 178389-06-5 |
English Synonyms: | WAY-132983 |
MDL Number.: | MFCD04034543 |
H bond acceptor: | 4 |
H bond donor: | 0 |
Smile: | CCCCCCSc1c(nccn1)O[C@H]2CN3CC[C@@H]2C3.Cl |
InChi: | InChI=1S/C16H25N3OS.ClH/c1-2-3-4-5-10-21-16-15(17-7-8-18-16)20-14-12-19-9-6-13(14)11-19;/h7-8,13-14H,2-6,9-12H2,1H3;1H/t13-,14+;/m1./s1 |
InChiKey: | InChIKey=QAXRREHLPKHWBI-DFQHDRSWSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.