* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | XANTHININ |
| CAS: | 153483-31-9 |
| English Synonyms: | XANTHININ |
| MDL Number.: | MFCD04112796 |
| H bond acceptor: | 5 |
| H bond donor: | 0 |
| Smile: | CC1CC2C(CC=C1C(CC(=O)C)OC(=O)C)C(=C)C(=O)O2 |
| InChi: | InChI=1S/C17H22O5/c1-9-7-15-14(11(3)17(20)22-15)6-5-13(9)16(8-10(2)18)21-12(4)19/h5,9,14-16H,3,6-8H2,1-2,4H3 |
| InChiKey: | InChIKey=DPSCQKGSAHTWSP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.