* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | KINGSHCHEM 63223 |
| English Synonyms: | KINGSHCHEM 63223 |
| MDL Number.: | MFCD06345745 |
| H bond acceptor: | 5 |
| H bond donor: | 0 |
| Smile: | CCOC(=O)c1cn(nc1c2ccncc2)c3ccccc3 |
| InChi: | InChI=1S/C17H15N3O2/c1-2-22-17(21)15-12-20(14-6-4-3-5-7-14)19-16(15)13-8-10-18-11-9-13/h3-12H,2H2,1H3 |
| InChiKey: | InChIKey=OFGQNJVPRBJECY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.