* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | GW 274150 |
| CAS: | 210354-22-6 |
| English Synonyms: | GW 274150 |
| MDL Number.: | MFCD07363946 |
| H bond acceptor: | 5 |
| H bond donor: | 4 |
| Smile: | CC(=N)NCCSCC[C@@H](C(=O)O)N |
| InChi: | InChI=1S/C8H17N3O2S/c1-6(9)11-3-5-14-4-2-7(10)8(12)13/h7H,2-5,10H2,1H3,(H2,9,11)(H,12,13)/t7-/m0/s1 |
| InChiKey: | InChIKey=MOLOJNHYNHBPCW-ZETCQYMHSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.