* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | JTE-607 |
| English Synonyms: | JTE-607 |
| MDL Number.: | MFCD07363998 |
| H bond acceptor: | 8 |
| H bond donor: | 2 |
| Smile: | CCOC(=O)[C@H](Cc1ccccc1)NC(=O)c2cc(c(c(c2O)Cl)OCCN3CCN(CC3)C)Cl.Cl.Cl |
| InChi: | InChI=1S/C25H31Cl2N3O5.2ClH/c1-3-34-25(33)20(15-17-7-5-4-6-8-17)28-24(32)18-16-19(26)23(21(27)22(18)31)35-14-13-30-11-9-29(2)10-12-30;;/h4-8,16,20,31H,3,9-15H2,1-2H3,(H,28,32);2*1H/t20-;;/m0../s1 |
| InChiKey: | InChIKey=JUJAUEQJEWIWCQ-FJSYBICCSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.