* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-(4-BROMOBENZOYL)-6-ETHYL-7A,8-DIHYDRO-4AH-PYRROLO(3',4':3,4)PYRROLO(1,2-B)PYRIDAZINE-5,7(4BH,6H)-DIONE |
| CAS: | 882865-47-6 |
| English Synonyms: | 8-(4-BROMOBENZOYL)-6-ETHYL-7A,8-DIHYDRO-4AH-PYRROLO(3',4':3,4)PYRROLO(1,2-B)PYRIDAZINE-5,7(4BH,6H)-DIONE |
| MDL Number.: | MFCD08282546 |
| H bond acceptor: | 6 |
| H bond donor: | 0 |
| Smile: | CCN1C(=O)C2C3C=CC=NN3C(C2C1=O)C(=O)c4ccc(cc4)Br |
| InChi: | InChI=1S/C18H16BrN3O3/c1-2-21-17(24)13-12-4-3-9-20-22(12)15(14(13)18(21)25)16(23)10-5-7-11(19)8-6-10/h3-9,12-15H,2H2,1H3 |
| InChiKey: | InChIKey=LJXBTSPSWGZQCB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.