* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-(4-BROMOBENZOYL)-10-ETHYL-11A,11B-DIHYDRO-8H-PYRROLO(3',4':3,4)PYRROLO(2,1-A)PHTHALAZINE-9,11(8AH,10H)-DIONE |
| CAS: | 882865-60-3 |
| English Synonyms: | 8-(4-BROMOBENZOYL)-10-ETHYL-11A,11B-DIHYDRO-8H-PYRROLO(3',4':3,4)PYRROLO(2,1-A)PHTHALAZINE-9,11(8AH,10H)-DIONE |
| MDL Number.: | MFCD08282557 |
| H bond acceptor: | 6 |
| H bond donor: | 0 |
| Smile: | CCN1C(=O)C2C3c4ccccc4C=NN3C(C2C1=O)C(=O)c5ccc(cc5)Br |
| InChi: | InChI=1S/C22H18BrN3O3/c1-2-25-21(28)16-17(22(25)29)19(20(27)12-7-9-14(23)10-8-12)26-18(16)15-6-4-3-5-13(15)11-24-26/h3-11,16-19H,2H2,1H3 |
| InChiKey: | InChIKey=KDQOSVIRCLXRBU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.