* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-METHYL-1H-PYRIDO[2,3-B][1,4]OXAZIN-2(3H)-ONE |
| English Synonyms: | 8-METHYL-1H-PYRIDO[2,3-B][1,4]OXAZIN-2(3H)-ONE |
| MDL Number.: | MFCD08692105 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | Cc1ccnc2c1NC(=O)CO2 |
| InChi: | InChI=1S/C8H8N2O2/c1-5-2-3-9-8-7(5)10-6(11)4-12-8/h2-3H,4H2,1H3,(H,10,11) |
| InChiKey: | InChIKey=RLGQPXISQBSASS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.