* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-METHYL-1H,2H,3H-PYRIDO[2,3-B][1,4]OXAZINE |
| English Synonyms: | 8-METHYL-1H,2H,3H-PYRIDO[2,3-B][1,4]OXAZINE ; 8-METHYL-2,3-DIHYDRO-1H-PYRIDO[2,3-B][1,4]OXAZINE |
| MDL Number.: | MFCD08692106 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | Cc1ccnc2c1NCCO2 |
| InChi: | InChI=1S/C8H10N2O/c1-6-2-3-10-8-7(6)9-4-5-11-8/h2-3,9H,4-5H2,1H3 |
| InChiKey: | InChIKey=WKSOTFJUMBKIPY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.