* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ZERENEX ZX-CF010646 |
| English Synonyms: | ZERENEX ZX-CF010646 |
| MDL Number.: | MFCD09030026 |
| H bond acceptor: | 3 |
| H bond donor: | 0 |
| Smile: | Cn1cccc1C(C#N)C2CCN(CC2)Cc3ccccc3 |
| InChi: | InChI=1S/C19H23N3/c1-21-11-5-8-19(21)18(14-20)17-9-12-22(13-10-17)15-16-6-3-2-4-7-16/h2-8,11,17-18H,9-10,12-13,15H2,1H3 |
| InChiKey: | InChIKey=BFRLWQIDHZHABS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.