* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ZERENEX ZX-CF013026 |
| English Synonyms: | ZERENEX ZX-CF013026 |
| MDL Number.: | MFCD09031266 |
| H bond acceptor: | 1 |
| H bond donor: | 1 |
| Smile: | C1=CC(C(=C1)CCO)S |
| InChi: | InChI=1S/C7H10OS/c8-5-4-6-2-1-3-7(6)9/h1-3,7-9H,4-5H2 |
| InChiKey: | InChIKey=MFCIMOFDGZHQAD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.