Molecular Structure:
CCD No.:CCD08224682
ZERENEX E/7090954
Formula:C19 H24 F N O3
MolWeight:333.401
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | ZERENEX E/7090954 |
| English Synonyms： | ZERENEX E/7090954 |
| MDL Number.： | MFCD09689763 |
| H bond acceptor： | 4 |
| H bond donor： | 1 |
| Smile： | COCCCNCc1cccc(c1OCc2ccc(cc2)F)OC |
| InChi： | InChI=1S/C19H24FNO3/c1-22-12-4-11-21-13-16-5-3-6-18(23-2)19(16)24-14-15-7-9-17(20)10-8-15/h3,5-10,21H,4,11-14H2,1-2H3 |
| InChiKey： | InChIKey=MPPOVIABSMJIMH-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
