Molecular Structure:
CCD No.:CCD08224824
ZERENEX E/7091107
Formula:C26 H27 N9 O2 S
MolWeight:529.626
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | ZERENEX E/7091107 |
| English Synonyms： | ZERENEX E/7091107 |
| MDL Number.： | MFCD09691594 |
| H bond acceptor： | 11 |
| H bond donor： | 1 |
| Smile： | CCOc1cc(ccc1Oc2nnnn2c3ccccc3)CNCCCSc4nnnn4c5ccccc5 |
| InChi： | InChI=1S/C26H27N9O2S/c1-2-36-24-18-20(14-15-23(24)37-25-28-30-32-34(25)21-10-5-3-6-11-21)19-27-16-9-17-38-26-29-31-33-35(26)22-12-7-4-8-13-22/h3-8,10-15,18,27H,2,9,16-17,19H2,1H3 |
| InChiKey： | InChIKey=JLUHNWYYLPKUFE-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
