Molecular Structure:
CCD No.:CCD08224921
ZERENEX E/7091268
Formula:C22 H28 N2 O3
MolWeight:368.474
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | ZERENEX E/7091268 |
| English Synonyms： | ZERENEX E/7091268 |
| MDL Number.： | MFCD09692144 |
| H bond acceptor： | 5 |
| H bond donor： | 2 |
| Smile： | Cc1ccc(cc1)NC(=O)COc2ccc(cc2OC)CNC3CCCC3 |
| InChi： | InChI=1S/C22H28N2O3/c1-16-7-10-19(11-8-16)24-22(25)15-27-20-12-9-17(13-21(20)26-2)14-23-18-5-3-4-6-18/h7-13,18,23H,3-6,14-15H2,1-2H3,(H,24,25) |
| InChiKey： | InChIKey=KZRIKUXMOYLQHM-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
