Molecular Structure:
CCD No.:CCD08224924
ZERENEX E/7091271
Formula:C21 H28 N2 O4
MolWeight:372.462
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | ZERENEX E/7091271 |
| English Synonyms： | ZERENEX E/7091271 |
| MDL Number.： | MFCD09692147 |
| H bond acceptor： | 6 |
| H bond donor： | 3 |
| Smile： | CCC(CO)NCc1ccc(c(c1)OC)OCC(=O)Nc2ccc(cc2)C |
| InChi： | InChI=1S/C21H28N2O4/c1-4-17(13-24)22-12-16-7-10-19(20(11-16)26-3)27-14-21(25)23-18-8-5-15(2)6-9-18/h5-11,17,22,24H,4,12-14H2,1-3H3,(H,23,25) |
| InChiKey： | InChIKey=ROAHVAFKMBGURT-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
