Molecular Structure:
CCD No.:CCD08224942
ZERENEX E/7091291
Formula:C20 H26 N2 O4
MolWeight:358.435
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | ZERENEX E/7091291 |
| English Synonyms： | ZERENEX E/7091291 |
| MDL Number.： | MFCD09692174 |
| H bond acceptor： | 6 |
| H bond donor： | 2 |
| Smile： | Cc1ccc(cc1)NC(=O)COc2ccc(cc2OC)CNCCOC |
| InChi： | InChI=1S/C20H26N2O4/c1-15-4-7-17(8-5-15)22-20(23)14-26-18-9-6-16(12-19(18)25-3)13-21-10-11-24-2/h4-9,12,21H,10-11,13-14H2,1-3H3,(H,22,23) |
| InChiKey： | InChIKey=HLJOWLACCJTDPZ-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
