Molecular Structure:
CCD No.:CCD08225053
ZERENEX E/7091432
Formula:C26 H38 Cl F N2 O2
MolWeight:465.049
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | ZERENEX E/7091432 |
| English Synonyms： | ZERENEX E/7091432 |
| MDL Number.： | MFCD09692738 |
| H bond acceptor： | 4 |
| H bond donor： | 1 |
| Smile： | CCCCN(CCCC)CCCNCc1cc(c(c(c1)Cl)OCc2ccc(cc2)F)OC |
| InChi： | InChI=1S/C26H38ClFN2O2/c1-4-6-14-30(15-7-5-2)16-8-13-29-19-22-17-24(27)26(25(18-22)31-3)32-20-21-9-11-23(28)12-10-21/h9-12,17-18,29H,4-8,13-16,19-20H2,1-3H3 |
| InChiKey： | InChIKey=JWSXHCWVZXURJV-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
