* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | GP-G |
| CAS: | 433726-76-2 |
| English Synonyms: | GP-G |
| MDL Number.: | MFCD09832568 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | CN1CCN(CC1)c2ccc3c(n2)c4ccccc4c(=O)[nH]3 |
| InChi: | InChI=1S/C17H18N4O/c1-20-8-10-21(11-9-20)15-7-6-14-16(19-15)12-4-2-3-5-13(12)17(22)18-14/h2-7H,8-11H2,1H3,(H,18,22) |
| InChiKey: | InChIKey=YRVTWLAUEOBDFG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.