* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | GUANYL UREA-15N4 |
CAS: | 1185070-88-5 |
English Synonyms: | GUANYL UREA-15N4 |
MDL Number.: | MFCD09840674 |
H bond acceptor: | 5 |
H bond donor: | 4 |
Smile: | C(=[15NH])([15NH2])[15NH]C(=O)[15NH2] |
InChi: | InChI=1S/C2H6N4O/c3-1(4)6-2(5)7/h(H6,3,4,5,6,7)/i3+1,4+1,5+1,6+1 |
InChiKey: | InChIKey=SQSPRWMERUQXNE-PQVJJBODSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.