* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB BBL010033 |
| English Synonyms: | VITAS-BB BBL010033 |
| MDL Number.: | MFCD10464955 |
| H bond acceptor: | 10 |
| H bond donor: | 5 |
| Smile: | COC(=O)C1=COC(C2C1CC=C2CO)OC3C(C(C(C(O3)CO)O)O)O |
| InChi: | InChI=1S/C17H24O10/c1-24-15(23)9-6-25-16(11-7(4-18)2-3-8(9)11)27-17-14(22)13(21)12(20)10(5-19)26-17/h2,6,8,10-14,16-22H,3-5H2,1H3 |
| InChiKey: | InChIKey=IBFYXTRXDNAPMM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.