* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-(ALLYLOXY)-4-CYCLOOCTEN-1-ONE |
| English Synonyms: | 8-(ALLYLOXY)-4-CYCLOOCTEN-1-ONE ; 8-(PROP-2-EN-1-YLOXY)CYCLOOCT-4-EN-1-ONE |
| MDL Number.: | MFCD11054985 |
| H bond acceptor: | 2 |
| H bond donor: | 0 |
| Smile: | C=CCOC1CC/C=C\CCC1=O |
| InChi: | InChI=1S/C11H16O2/c1-2-9-13-11-8-6-4-3-5-7-10(11)12/h2-4,11H,1,5-9H2/b4-3- |
| InChiKey: | InChIKey=LTHPPOXLWKZGLE-ARJAWSKDSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.