* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-THIA-1-AZABICYCLO[4.2.1]NON-4-ENE 8,8-DIOXIDE |
| English Synonyms: | 8-THIA-1-AZABICYCLO[4.2.1]NON-4-ENE 8,8-DIOXIDE |
| MDL Number.: | MFCD11055092 |
| H bond acceptor: | 3 |
| H bond donor: | 0 |
| Smile: | C1CN2CC(CS2(=O)=O)C=C1 |
| InChi: | InChI=1S/C7H11NO2S/c9-11(10)6-7-3-1-2-4-8(11)5-7/h1,3,7H,2,4-6H2 |
| InChiKey: | InChIKey=BYNLOQZZHWLICS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.