* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VIALININ A |
| CAS: | 858134-23-3 |
| English Synonyms: | VIALININ A ; 4,4'',5',6'-TETRAHYDROXY[1,1':4',1''-TERPHENYL]-2',3'-DIYL ESTER BENZENEACETIC ACID |
| MDL Number.: | MFCD11113135 |
| H bond acceptor: | 8 |
| H bond donor: | 4 |
| Smile: | c1ccc(cc1)CC(=O)Oc2c(c(c(c(c2OC(=O)Cc3ccccc3)c4ccc(cc4)O)O)O)c5ccc(cc5)O |
| InChi: | InChI=1S/C34H26O8/c35-25-15-11-23(12-16-25)29-31(39)32(40)30(24-13-17-26(36)18-14-24)34(42-28(38)20-22-9-5-2-6-10-22)33(29)41-27(37)19-21-7-3-1-4-8-21/h1-18,35-36,39-40H,19-20H2 |
| InChiKey: | InChIKey=NOJUKCRPSUMHQQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.