* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | JMV3002 |
| CAS: | 925239-03-8 |
| English Synonyms: | N-((1R)-1-(4-((2,4-DIMETHOXYPHENYL)METHYL)-5-(2-PHENYYLETHYL)-4H-1,2,4-TRIAZOL-3-YL)-2-(1H-INDOL-3-YL)ETHYL)-2-PYRIDINECARBOXAMIDE ; JMV3002 |
| MDL Number.: | MFCD11976902 |
| H bond acceptor: | 9 |
| H bond donor: | 2 |
| Smile: | COc1ccc(c(c1)OC)Cn2c(nnc2[C@@H](Cc3c[nH]c4c3cccc4)NC(=O)c5ccccn5)CCc6ccccc6 |
| InChi: | InChI=1S/C35H34N6O3/c1-43-27-17-16-25(32(21-27)44-2)23-41-33(18-15-24-10-4-3-5-11-24)39-40-34(41)31(38-35(42)30-14-8-9-19-36-30)20-26-22-37-29-13-7-6-12-28(26)29/h3-14,16-17,19,21-22,31,37H,15,18,20,23H2,1-2H3,(H,38,42)/t31-/m1/s1 |
| InChiKey: | InChIKey=UMGBPWZCCHVQAY-WJOKGBTCSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.